C17H37BBrNO2Si2 — CID 20700923
1-(5,7,7a-trimethyl-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]dioxaborol-2-yl)-2-bromo-N,N-bis(trimethylsilyl)ethanamine (PubChem CID 20700923) has the molecular formula C17H37BBrNO2Si2 and a molecular weight of 434.38 g/mol. Its IUPAC name is 1-(5,7,7a-trimethyl-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]dioxaborol-2-yl)-2-bromo-N,N-bis(trimethylsilyl)ethanamine.
| Compound Name | 1-(5,7,7a-trimethyl-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]dioxaborol-2-yl)-2-bromo-N,N-bis(trimethylsilyl)ethanamine |
|---|---|
| PubChem CID | 20700923 |
| Molecular Formula | C17H37BBrNO2Si2 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-(5,7,7a-trimethyl-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]dioxaborol-2-yl)-2-bromo-N,N-bis(trimethylsilyl)ethanamine |
| SMILES | CC1CC(C)C2(C)OB(C(CBr)N([Si](C)(C)C)[Si](C)(C)C)OC2C1 |
| InChI | InChI=1S/C17H37BBrNO2Si2/c1-13-10-14(2)17(3)15(11-13)21-18(22-17)16(12-19)20(23(4,5)6)24(7,8)9/h13-16H,10-12H2,1-9H3 |
| InChIKey | KFAXYHOVFSHYLZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|