C14H26BNO2 — CID 59041462
(1S)-2-methyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine (PubChem CID 59041462) has the molecular formula C14H26BNO2 and a molecular weight of 251.18 g/mol. Its IUPAC name is (1S)-2-methyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine.
| Compound Name | (1S)-2-methyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 59041462 |
| Molecular Formula | C14H26BNO2 |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | (1S)-2-methyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine |
| SMILES | CC(C)[C@@H](N)B1O[C@@H]2CC3CC(C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C14H26BNO2/c1-8(2)12(16)15-17-11-7-9-6-10(13(9,3)4)14(11,5)18-15/h8-12H,6-7,16H2,1-5H3/t9?,10?,11-,12-,14+/m1/s1 |
| InChIKey | UXOSNRCNFXNKSR-HQJGEMNHSA-N |
| XLogP | 2.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|