C14H23BF3NO4 — CID 71773564
2,2,2-trifluoroacetic acid;(1R)-1-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine (PubChem CID 71773564) has the molecular formula C14H23BF3NO4 and a molecular weight of 337.15 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;(1R)-1-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine.
| Compound Name | 2,2,2-trifluoroacetic acid;(1R)-1-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
|---|---|
| PubChem CID | 71773564 |
| Molecular Formula | C14H23BF3NO4 |
| Molecular Weight | 337.15 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;(1R)-1-[(1S,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
| SMILES | C[C@H](N)B1O[C@@H]2C[C@H]3C[C@@H](C3(C)C)[C@]2(C)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H22BNO2.C2HF3O2/c1-7(14)13-15-10-6-8-5-9(11(8,2)3)12(10,4)16-13;3-2(4,5)1(6)7/h7-10H,5-6,14H2,1-4H3;(H,6,7)/t7-,8+,9-,10+,12-;/m0./s1 |
| InChIKey | UIRPOZKMSMHJBQ-BNQQDEPSSA-N |
| XLogP | 2.23 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|