C13H24BNO2 — CID 58021886
(1R)-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine (PubChem CID 58021886) has the molecular formula C13H24BNO2 and a molecular weight of 237.15 g/mol. Its IUPAC name is (1R)-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine.
| Compound Name | (1R)-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 58021886 |
| Molecular Formula | C13H24BNO2 |
| Molecular Weight | 237.15 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | (1R)-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine |
| SMILES | CC[C@H](N)B1O[C@@H]2C[C@H]3C[C@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C13H24BNO2/c1-5-11(15)14-16-10-7-8-6-9(12(8,2)3)13(10,4)17-14/h8-11H,5-7,15H2,1-4H3/t8-,9-,10-,11+,13+/m1/s1 |
| InChIKey | SKKIMXQAZGPDGP-YFVNTRNASA-N |
| XLogP | 1.99 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|