C15H28BNO3 — CID 70267328
(5S)-5-amino-5-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-1-ol (PubChem CID 70267328) has the molecular formula C15H28BNO3 and a molecular weight of 281.20 g/mol. Its IUPAC name is (5S)-5-amino-5-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-1-ol.
| Compound Name | (5S)-5-amino-5-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-1-ol |
|---|---|
| PubChem CID | 70267328 |
| Molecular Formula | C15H28BNO3 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | (5S)-5-amino-5-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-1-ol |
| SMILES | CC1(C)[C@H]2CC3OB([C@H](N)CCCCO)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C15H28BNO3/c1-14(2)10-8-11(14)15(3)12(9-10)19-16(20-15)13(17)6-4-5-7-18/h10-13,18H,4-9,17H2,1-3H3/t10-,11-,12?,13-,15-/m1/s1 |
| InChIKey | ZEMIZZUJSWZYJU-PPZQWCPPSA-N |
| XLogP | 1.74 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|