C16H28BNO2 — CID 59267324
(1R)-2-cyclobutyl-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine (PubChem CID 59267324) has the molecular formula C16H28BNO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is (1R)-2-cyclobutyl-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine.
| Compound Name | (1R)-2-cyclobutyl-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
|---|---|
| PubChem CID | 59267324 |
| Molecular Formula | C16H28BNO2 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (1R)-2-cyclobutyl-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
| SMILES | CC1(C)C2CC3OB([C@@H](N)CC4CCC4)O[C@@]3(C)C1C2 |
| InChI | InChI=1S/C16H28BNO2/c1-15(2)11-8-12(15)16(3)13(9-11)19-17(20-16)14(18)7-10-5-4-6-10/h10-14H,4-9,18H2,1-3H3/t11?,12?,13?,14-,16-/m0/s1 |
| InChIKey | VYYNWRNPIVUKAN-XJCKWLDASA-N |
| XLogP | 2.77 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|