C18H26BNO2 — CID 57358170
2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine (PubChem CID 57358170) has the molecular formula C18H26BNO2 and a molecular weight of 299.22 g/mol. Its IUPAC name is 2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine.
| Compound Name | 2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
|---|---|
| PubChem CID | 57358170 |
| Molecular Formula | C18H26BNO2 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB(C(N)Cc4ccccc4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C18H26BNO2/c1-17(2)13-10-14(17)18(3)15(11-13)21-19(22-18)16(20)9-12-7-5-4-6-8-12/h4-8,13-16H,9-11,20H2,1-3H3/t13-,14-,15+,16?,18-/m0/s1 |
| InChIKey | VBPSRSJQIVBEOE-ZOWQXGHRSA-N |
| XLogP | 2.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|