C25H36BNO3 — CID 159474852
2-amino-6-cyclopropyl-1-phenyl-5-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexan-3-one (PubChem CID 159474852) has the molecular formula C25H36BNO3 and a molecular weight of 409.38 g/mol. Its IUPAC name is 2-amino-6-cyclopropyl-1-phenyl-5-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexan-3-one.
| Compound Name | 2-amino-6-cyclopropyl-1-phenyl-5-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexan-3-one |
|---|---|
| PubChem CID | 159474852 |
| Molecular Formula | C25H36BNO3 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 2-amino-6-cyclopropyl-1-phenyl-5-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexan-3-one |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB(C(CC(=O)C(N)Cc4ccccc4)CC4CC4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C25H36BNO3/c1-24(2)18-13-22(24)25(3)23(14-18)29-26(30-25)19(11-17-9-10-17)15-21(28)20(27)12-16-7-5-4-6-8-16/h4-8,17-20,22-23H,9-15,27H2,1-3H3/t18-,19?,20?,22-,23+,25-/m0/s1 |
| InChIKey | OWVOQWFOBHTRCX-NOJZYZBOSA-N |
| XLogP | 4.41 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|