C26H37BN2O5 — CID 68531322
[(2S)-1-[[(1R)-2-cyclobutyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamic acid (PubChem CID 68531322) has the molecular formula C26H37BN2O5 and a molecular weight of 468.40 g/mol. Its IUPAC name is [(2S)-1-[[(1R)-2-cyclobutyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[(1R)-2-cyclobutyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68531322 |
| Molecular Formula | C26H37BN2O5 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | [(2S)-1-[[(1R)-2-cyclobutyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamic acid |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](CC4CCC4)NC(=O)[C@H](Cc4ccccc4)NC(=O)O)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C26H37BN2O5/c1-25(2)18-14-20(25)26(3)21(15-18)33-27(34-26)22(13-17-10-7-11-17)29-23(30)19(28-24(31)32)12-16-8-5-4-6-9-16/h4-6,8-9,17-22,28H,7,10-15H2,1-3H3,(H,29,30)(H,31,32)/t18-,19-,20-,21+,22-,26-/m0/s1 |
| InChIKey | AVYFYMKYMRWPRW-MRULDHGVSA-N |
| XLogP | 3.81 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|