C20H33BN2O6 — CID 174051941
[1-[[(1R)-2-cyclopropyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamic acid (PubChem CID 174051941) has the molecular formula C20H33BN2O6 and a molecular weight of 408.30 g/mol. Its IUPAC name is [1-[[(1R)-2-cyclopropyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-[[(1R)-2-cyclopropyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174051941 |
| Molecular Formula | C20H33BN2O6 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [1-[[(1R)-2-cyclopropyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamic acid |
| SMILES | COCC(NC(=O)O)C(=O)N[C@@H](CC1CC1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C20H33BN2O6/c1-19(2)12-8-14(19)20(3)15(9-12)28-21(29-20)16(7-11-5-6-11)23-17(24)13(10-27-4)22-18(25)26/h11-16,22H,5-10H2,1-4H3,(H,23,24)(H,25,26)/t12-,13?,14-,15+,16-,20-/m0/s1 |
| InChIKey | KOYJYCDXYPCAKO-ZXTMUDNASA-N |
| XLogP | 1.82 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|