C24H35BN2O5 — CID 177297146
(2R)-2-amino-3-methoxy-N-[(1R)-4-oxo-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide (PubChem CID 177297146) has the molecular formula C24H35BN2O5 and a molecular weight of 442.37 g/mol. Its IUPAC name is (2R)-2-amino-3-methoxy-N-[(1R)-4-oxo-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide.
| Compound Name | (2R)-2-amino-3-methoxy-N-[(1R)-4-oxo-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide |
|---|---|
| PubChem CID | 177297146 |
| Molecular Formula | C24H35BN2O5 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | (2R)-2-amino-3-methoxy-N-[(1R)-4-oxo-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide |
| SMILES | COC[C@@H](N)C(=O)N[C@@H](CCC(=O)c1ccccc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C24H35BN2O5/c1-23(2)16-12-19(23)24(3)20(13-16)31-25(32-24)21(27-22(29)17(26)14-30-4)11-10-18(28)15-8-6-5-7-9-15/h5-9,16-17,19-21H,10-14,26H2,1-4H3,(H,27,29)/t16-,17+,19-,20+,21-,24-/m0/s1 |
| InChIKey | KITNWYSKKWGNKQ-SCPLQFNXSA-N |
| XLogP | 2.38 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|