C28H42BNO6 — CID 58301689
benzyl (3S,4R)-4-hydroxy-3-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoyl]pentanoate (PubChem CID 58301689) has the molecular formula C28H42BNO6 and a molecular weight of 499.46 g/mol. Its IUPAC name is benzyl (3S,4R)-4-hydroxy-3-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoyl]pentanoate.
| Compound Name | benzyl (3S,4R)-4-hydroxy-3-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoyl]pentanoate |
|---|---|
| PubChem CID | 58301689 |
| Molecular Formula | C28H42BNO6 |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | benzyl (3S,4R)-4-hydroxy-3-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoyl]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC(=O)OCc1ccccc1)[C@@H](C)O)B1O[C@@H]2C[C@H]3C[C@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C28H42BNO6/c1-17(2)12-24(29-35-23-14-20-13-22(27(20,4)5)28(23,6)36-29)30-26(33)21(18(3)31)15-25(32)34-16-19-10-8-7-9-11-19/h7-11,17-18,20-24,31H,12-16H2,1-6H3,(H,30,33)/t18-,20-,21+,22-,23-,24+,28+/m1/s1 |
| InChIKey | DHMVVEKOCXPDIY-XWVRRHESSA-N |
| XLogP | 3.92 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|