C32H50BN3O6 — CID 90655055
(2S)-2-acetamido-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-N'-(4-phenylmethoxybutyl)butanediamide (PubChem CID 90655055) has the molecular formula C32H50BN3O6 and a molecular weight of 583.58 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-N'-(4-phenylmethoxybutyl)butanediamide.
| Compound Name | (2S)-2-acetamido-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-N'-(4-phenylmethoxybutyl)butanediamide |
|---|---|
| PubChem CID | 90655055 |
| Molecular Formula | C32H50BN3O6 |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.38 |
| IUPAC Name | (2S)-2-acetamido-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-N'-(4-phenylmethoxybutyl)butanediamide |
| SMILES | CC(=O)N[C@@H](CC(=O)NCCCCOCc1ccccc1)C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C32H50BN3O6/c1-21(2)16-28(33-41-27-18-24-17-26(31(24,4)5)32(27,6)42-33)36-30(39)25(35-22(3)37)19-29(38)34-14-10-11-15-40-20-23-12-8-7-9-13-23/h7-9,12-13,21,24-28H,10-11,14-20H2,1-6H3,(H,34,38)(H,35,37)(H,36,39)/t24-,25-,26-,27+,28-,32-/m0/s1 |
| InChIKey | ODIWGDQSSAWSIL-GKWCIWIWSA-N |
| XLogP | 3.79 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|