C33H45BN2O5 — CID 10187852
(2S)-2-[[2-(2-methoxyphenyl)acetyl]amino]-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-3-phenylpropanamide (PubChem CID 10187852) has the molecular formula C33H45BN2O5 and a molecular weight of 560.54 g/mol. Its IUPAC name is (2S)-2-[[2-(2-methoxyphenyl)acetyl]amino]-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-(2-methoxyphenyl)acetyl]amino]-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 10187852 |
| Molecular Formula | C33H45BN2O5 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | (2S)-2-[[2-(2-methoxyphenyl)acetyl]amino]-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-3-phenylpropanamide |
| SMILES | COc1ccccc1CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@H]3C[C@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C33H45BN2O5/c1-21(2)16-29(34-40-28-20-24-19-27(32(24,3)4)33(28,5)41-34)36-31(38)25(17-22-12-8-7-9-13-22)35-30(37)18-23-14-10-11-15-26(23)39-6/h7-15,21,24-25,27-29H,16-20H2,1-6H3,(H,35,37)(H,36,38)/t24-,25+,27-,28-,29+,33+/m1/s1 |
| InChIKey | PAOQAWZLQODSJS-LJGLXBCVSA-N |
| XLogP | 4.76 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|