C38H48BN3O5 — CID 145293983
(2S)-2-[[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoylamino]-3-phenyl-N-(3-phenylmethoxyphenyl)propanamide (PubChem CID 145293983) has the molecular formula C38H48BN3O5 and a molecular weight of 637.63 g/mol. Its IUPAC name is (2S)-2-[[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoylamino]-3-phenyl-N-(3-phenylmethoxyphenyl)propanamide.
| Compound Name | (2S)-2-[[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoylamino]-3-phenyl-N-(3-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 145293983 |
| Molecular Formula | C38H48BN3O5 |
| Molecular Weight | 637.63 g/mol |
| Exact Mass | 637.37 |
| IUPAC Name | (2S)-2-[[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoylamino]-3-phenyl-N-(3-phenylmethoxyphenyl)propanamide |
| SMILES | CC(C)C[C@H](NC(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1cccc(OCc2ccccc2)c1)B1OC2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C38H48BN3O5/c1-25(2)19-34(39-46-33-22-28-21-32(37(28,3)4)38(33,5)47-39)42-36(44)41-31(20-26-13-8-6-9-14-26)35(43)40-29-17-12-18-30(23-29)45-24-27-15-10-7-11-16-27/h6-18,23,25,28,31-34H,19-22,24H2,1-5H3,(H,40,43)(H2,41,42,44)/t28-,31+,32-,33?,34+,38-/m1/s1 |
| InChIKey | ZWSNWYFEXWXCMY-NGLRVZOVSA-N |
| XLogP | 6.80 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|