C32H41BF2N2O5 — CID 53362308
benzyl N-[(2S)-3-(3,5-difluorophenyl)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 53362308) has the molecular formula C32H41BF2N2O5 and a molecular weight of 582.50 g/mol. Its IUPAC name is benzyl N-[(2S)-3-(3,5-difluorophenyl)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-(3,5-difluorophenyl)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 53362308 |
| Molecular Formula | C32H41BF2N2O5 |
| Molecular Weight | 582.50 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | benzyl N-[(2S)-3-(3,5-difluorophenyl)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)OCc1ccccc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C32H41BF2N2O5/c1-19(2)11-28(33-41-27-16-22-15-26(31(22,3)4)32(27,5)42-33)37-29(38)25(14-21-12-23(34)17-24(35)13-21)36-30(39)40-18-20-9-7-6-8-10-20/h6-10,12-13,17,19,22,25-28H,11,14-16,18H2,1-5H3,(H,36,39)(H,37,38)/t22-,25-,26-,27+,28-,32-/m0/s1 |
| InChIKey | MXHHKGHEVLRXQT-BDXUCNEISA-N |
| XLogP | 5.60 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|