C30H41BN2O4S — CID 10280293
(2S)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-3-phenyl-2-[(2-thiophen-3-ylacetyl)amino]propanamide (PubChem CID 10280293) has the molecular formula C30H41BN2O4S and a molecular weight of 536.55 g/mol. Its IUPAC name is (2S)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-3-phenyl-2-[(2-thiophen-3-ylacetyl)amino]propanamide.
| Compound Name | (2S)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-3-phenyl-2-[(2-thiophen-3-ylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 10280293 |
| Molecular Formula | C30H41BN2O4S |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | (2S)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-3-phenyl-2-[(2-thiophen-3-ylacetyl)amino]propanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)Cc1ccsc1)B1O[C@@H]2C[C@H]3C[C@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C30H41BN2O4S/c1-19(2)13-26(31-36-25-17-22-16-24(29(22,3)4)30(25,5)37-31)33-28(35)23(14-20-9-7-6-8-10-20)32-27(34)15-21-11-12-38-18-21/h6-12,18-19,22-26H,13-17H2,1-5H3,(H,32,34)(H,33,35)/t22-,23+,24-,25-,26+,30+/m1/s1 |
| InChIKey | QVBOTQAKURLTRL-GJYYSVMYSA-N |
| XLogP | 4.82 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|