C21H39BN2O3 — CID 53362199
(2S)-2-amino-4-methyl-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide (PubChem CID 53362199) has the molecular formula C21H39BN2O3 and a molecular weight of 378.37 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide |
|---|---|
| PubChem CID | 53362199 |
| Molecular Formula | C21H39BN2O3 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C21H39BN2O3/c1-12(2)8-15(23)19(25)24-18(9-13(3)4)22-26-17-11-14-10-16(20(14,5)6)21(17,7)27-22/h12-18H,8-11,23H2,1-7H3,(H,24,25)/t14-,15-,16-,17+,18-,21-/m0/s1 |
| InChIKey | XVNFOJDUURVSFI-CLCCAKIRSA-N |
| XLogP | 3.16 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|