C28H45BClN3O6 — CID 162339323
(2S)-2-amino-3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide;hydrochloride (PubChem CID 162339323) has the molecular formula C28H45BClN3O6 and a molecular weight of 565.95 g/mol. Its IUPAC name is (2S)-2-amino-3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide;hydrochloride.
| Compound Name | (2S)-2-amino-3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 162339323 |
| Molecular Formula | C28H45BClN3O6 |
| Molecular Weight | 565.95 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | (2S)-2-amino-3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide;hydrochloride |
| SMILES | COc1ccc(CC(=O)NC[C@H](N)C(=O)N[C@@H](CC(C)C)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cc1OC.Cl |
| InChI | InChI=1S/C28H44BN3O6.ClH/c1-16(2)10-24(29-37-23-14-18-13-22(27(18,3)4)28(23,5)38-29)32-26(34)19(30)15-31-25(33)12-17-8-9-20(35-6)21(11-17)36-7;/h8-9,11,16,18-19,22-24H,10,12-15,30H2,1-7H3,(H,31,33)(H,32,34);1H/t18-,19-,22-,23+,24-,28-;/m0./s1 |
| InChIKey | NZKDVGOPJPXYIA-IPKRUQEESA-N |
| XLogP | 2.91 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.95 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|