C25H43BN2O6 — CID 58301998
ethyl (7S)-7-amino-8-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4,8-dioxooctanoate (PubChem CID 58301998) has the molecular formula C25H43BN2O6 and a molecular weight of 478.44 g/mol. Its IUPAC name is ethyl (7S)-7-amino-8-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4,8-dioxooctanoate.
| Compound Name | ethyl (7S)-7-amino-8-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4,8-dioxooctanoate |
|---|---|
| PubChem CID | 58301998 |
| Molecular Formula | C25H43BN2O6 |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | ethyl (7S)-7-amino-8-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4,8-dioxooctanoate |
| SMILES | CCOC(=O)CCC(=O)CC[C@H](N)C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@H]3C[C@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C25H43BN2O6/c1-7-32-22(30)11-9-17(29)8-10-18(27)23(31)28-21(12-15(2)3)26-33-20-14-16-13-19(24(16,4)5)25(20,6)34-26/h15-16,18-21H,7-14,27H2,1-6H3,(H,28,31)/t16-,18+,19-,20-,21+,25+/m1/s1 |
| InChIKey | PUTLHVKAGOYMAN-HHVOMBJHSA-N |
| XLogP | 2.80 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|