C22H37BN4O3 — CID 163991291
(2S)-2-amino-N-[(1R)-4-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]-3-pyrazol-1-ylpropanamide (PubChem CID 163991291) has the molecular formula C22H37BN4O3 and a molecular weight of 416.38 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1R)-4-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]-3-pyrazol-1-ylpropanamide.
| Compound Name | (2S)-2-amino-N-[(1R)-4-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]-3-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 163991291 |
| Molecular Formula | C22H37BN4O3 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | (2S)-2-amino-N-[(1R)-4-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]-3-pyrazol-1-ylpropanamide |
| SMILES | CC(C)CC[C@H](NC(=O)[C@@H](N)Cn1cccn1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C22H37BN4O3/c1-14(2)7-8-19(26-20(28)16(24)13-27-10-6-9-25-27)23-29-18-12-15-11-17(21(15,3)4)22(18,5)30-23/h6,9-10,14-19H,7-8,11-13,24H2,1-5H3,(H,26,28)/t15-,16-,17-,18+,19-,22-/m0/s1 |
| InChIKey | UAVHBBDVGWNWEG-BTWKCTJFSA-N |
| XLogP | 2.40 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|