C26H39BN2O4 — CID 174051303
2-amino-3-cyclopropyloxy-N-[4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide (PubChem CID 174051303) has the molecular formula C26H39BN2O4 and a molecular weight of 454.42 g/mol. Its IUPAC name is 2-amino-3-cyclopropyloxy-N-[4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide.
| Compound Name | 2-amino-3-cyclopropyloxy-N-[4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide |
|---|---|
| PubChem CID | 174051303 |
| Molecular Formula | C26H39BN2O4 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 2-amino-3-cyclopropyloxy-N-[4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB(C(CCCc4ccccc4)NC(=O)C(N)COC4CC4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C26H39BN2O4/c1-25(2)18-14-21(25)26(3)22(15-18)32-27(33-26)23(11-7-10-17-8-5-4-6-9-17)29-24(30)20(28)16-31-19-12-13-19/h4-6,8-9,18-23H,7,10-16,28H2,1-3H3,(H,29,30)/t18-,20?,21-,22+,23?,26-/m0/s1 |
| InChIKey | OZOHPBYQZGYRJI-QGDWNTITSA-N |
| XLogP | 3.27 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|