C31H41BN4O5 — CID 177297211
3-[(2R)-3-cyclopropyloxy-1-oxo-1-[[(1R)-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide (PubChem CID 177297211) has the molecular formula C31H41BN4O5 and a molecular weight of 560.50 g/mol. Its IUPAC name is 3-[(2R)-3-cyclopropyloxy-1-oxo-1-[[(1R)-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3-[(2R)-3-cyclopropyloxy-1-oxo-1-[[(1R)-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 177297211 |
| Molecular Formula | C31H41BN4O5 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | 3-[(2R)-3-cyclopropyloxy-1-oxo-1-[[(1R)-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](CCCc4ccccc4)NC(=O)[C@@H](COC4CC4)c4nccnc4C(N)=O)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C31H41BN4O5/c1-30(2)20-16-23(30)31(3)24(17-20)40-32(41-31)25(11-7-10-19-8-5-4-6-9-19)36-29(38)22(18-39-21-12-13-21)26-27(28(33)37)35-15-14-34-26/h4-6,8-9,14-15,20-25H,7,10-13,16-18H2,1-3H3,(H2,33,37)(H,36,38)/t20-,22-,23-,24+,25-,31-/m0/s1 |
| InChIKey | AROJHHNMBOJPBE-HIDJHYRQSA-N |
| XLogP | 3.61 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|