C31H38BN5O5 — CID 174052369
N-[(2S)-3-(1,3-oxazol-2-yl)-1-oxo-1-[[(1R)-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide (PubChem CID 174052369) has the molecular formula C31H38BN5O5 and a molecular weight of 571.49 g/mol. Its IUPAC name is N-[(2S)-3-(1,3-oxazol-2-yl)-1-oxo-1-[[(1R)-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S)-3-(1,3-oxazol-2-yl)-1-oxo-1-[[(1R)-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174052369 |
| Molecular Formula | C31H38BN5O5 |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | N-[(2S)-3-(1,3-oxazol-2-yl)-1-oxo-1-[[(1R)-4-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]propan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](CCCc4ccccc4)NC(=O)[C@H](Cc4ncco4)NC(=O)c4cnccn4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C31H38BN5O5/c1-30(2)21-16-24(30)31(3)25(17-21)41-32(42-31)26(11-7-10-20-8-5-4-6-9-20)37-28(38)22(18-27-35-14-15-40-27)36-29(39)23-19-33-12-13-34-23/h4-6,8-9,12-15,19,21-22,24-26H,7,10-11,16-18H2,1-3H3,(H,36,39)(H,37,38)/t21-,22-,24-,25+,26-,31-/m0/s1 |
| InChIKey | ZJBZUESYIPOUST-WEGNSSQSSA-N |
| XLogP | 3.58 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|