C21H24BN5O5 — CID 168920322
[(1R)-1-[[3-(1,3-oxazol-2-yl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid (PubChem CID 168920322) has the molecular formula C21H24BN5O5 and a molecular weight of 437.27 g/mol. Its IUPAC name is [(1R)-1-[[3-(1,3-oxazol-2-yl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[3-(1,3-oxazol-2-yl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid |
|---|---|
| PubChem CID | 168920322 |
| Molecular Formula | C21H24BN5O5 |
| Molecular Weight | 437.27 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | [(1R)-1-[[3-(1,3-oxazol-2-yl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid |
| SMILES | O=C(NC(Cc1ncco1)C(=O)N[C@@H](CCCc1ccccc1)B(O)O)c1cnccn1 |
| InChI | InChI=1S/C21H24BN5O5/c28-20(27-18(22(30)31)8-4-7-15-5-2-1-3-6-15)16(13-19-25-11-12-32-19)26-21(29)17-14-23-9-10-24-17/h1-3,5-6,9-12,14,16,18,30-31H,4,7-8,13H2,(H,26,29)(H,27,28)/t16?,18-/m0/s1 |
| InChIKey | NNDNPRVVKUMYLM-DAFXYXGESA-N |
| XLogP | 0.33 |
| TPSA | 150.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|