C22H26BN5O5 — CID 174072765
[(1R)-1-[[2-formyl-3-(1,3-oxazol-2-yl)-2-(pyrazine-2-carbonylamino)propyl]amino]-4-phenylbutyl]boronic acid (PubChem CID 174072765) has the molecular formula C22H26BN5O5 and a molecular weight of 451.29 g/mol. Its IUPAC name is [(1R)-1-[[2-formyl-3-(1,3-oxazol-2-yl)-2-(pyrazine-2-carbonylamino)propyl]amino]-4-phenylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[2-formyl-3-(1,3-oxazol-2-yl)-2-(pyrazine-2-carbonylamino)propyl]amino]-4-phenylbutyl]boronic acid |
|---|---|
| PubChem CID | 174072765 |
| Molecular Formula | C22H26BN5O5 |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | [(1R)-1-[[2-formyl-3-(1,3-oxazol-2-yl)-2-(pyrazine-2-carbonylamino)propyl]amino]-4-phenylbutyl]boronic acid |
| SMILES | O=CC(CN[C@@H](CCCc1ccccc1)B(O)O)(Cc1ncco1)NC(=O)c1cnccn1 |
| InChI | InChI=1S/C22H26BN5O5/c29-16-22(13-20-26-11-12-33-20,28-21(30)18-14-24-9-10-25-18)15-27-19(23(31)32)8-4-7-17-5-2-1-3-6-17/h1-3,5-6,9-12,14,16,19,27,31-32H,4,7-8,13,15H2,(H,28,30)/t19-,22?/m0/s1 |
| InChIKey | QVZRDZWRMQHBQO-YDNXMHBPSA-N |
| XLogP | 0.37 |
| TPSA | 150.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|