C15H17BN4O4 — CID 142596570
[2-phenyl-1-[[2-(pyrazine-2-carbonylamino)acetyl]amino]ethyl]boronic acid (PubChem CID 142596570) has the molecular formula C15H17BN4O4 and a molecular weight of 328.14 g/mol. Its IUPAC name is [2-phenyl-1-[[2-(pyrazine-2-carbonylamino)acetyl]amino]ethyl]boronic acid.
| Compound Name | [2-phenyl-1-[[2-(pyrazine-2-carbonylamino)acetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 142596570 |
| Molecular Formula | C15H17BN4O4 |
| Molecular Weight | 328.14 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [2-phenyl-1-[[2-(pyrazine-2-carbonylamino)acetyl]amino]ethyl]boronic acid |
| SMILES | O=C(CNC(=O)c1cnccn1)NC(Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C15H17BN4O4/c21-14(10-19-15(22)12-9-17-6-7-18-12)20-13(16(23)24)8-11-4-2-1-3-5-11/h1-7,9,13,23-24H,8,10H2,(H,19,22)(H,20,21) |
| InChIKey | GYAXOSRAYCAFSN-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.14 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|