C12H18N4O3 — CID 144733404
N-[2-[[(1R)-1-hydroxy-3-methylbutyl]amino]-2-oxoethyl]pyrazine-2-carboxamide (PubChem CID 144733404) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[2-[[(1R)-1-hydroxy-3-methylbutyl]amino]-2-oxoethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[[(1R)-1-hydroxy-3-methylbutyl]amino]-2-oxoethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 144733404 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-[2-[[(1R)-1-hydroxy-3-methylbutyl]amino]-2-oxoethyl]pyrazine-2-carboxamide |
| SMILES | CC(C)C[C@@H](O)NC(=O)CNC(=O)c1cnccn1 |
| InChI | InChI=1S/C12H18N4O3/c1-8(2)5-10(17)16-11(18)7-15-12(19)9-6-13-3-4-14-9/h3-4,6,8,10,17H,5,7H2,1-2H3,(H,15,19)(H,16,18)/t10-/m1/s1 |
| InChIKey | UTZJIDZDMTVQLL-SNVBAGLBSA-N |
| XLogP | -0.31 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|