C11H15N5O3 — CID 70297294
N-[2-[[(2S)-1-amino-1-oxobutan-2-yl]amino]-2-oxoethyl]pyrazine-2-carboxamide (PubChem CID 70297294) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is N-[2-[[(2S)-1-amino-1-oxobutan-2-yl]amino]-2-oxoethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[[(2S)-1-amino-1-oxobutan-2-yl]amino]-2-oxoethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70297294 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-[2-[[(2S)-1-amino-1-oxobutan-2-yl]amino]-2-oxoethyl]pyrazine-2-carboxamide |
| SMILES | CC[C@H](NC(=O)CNC(=O)c1cnccn1)C(N)=O |
| InChI | InChI=1S/C11H15N5O3/c1-2-7(10(12)18)16-9(17)6-15-11(19)8-5-13-3-4-14-8/h3-5,7H,2,6H2,1H3,(H2,12,18)(H,15,19)(H,16,17)/t7-/m0/s1 |
| InChIKey | PUJKTLCFKMUMLA-ZETCQYMHSA-N |
| XLogP | -1.41 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |