C13H18N4O3 — CID 142990533
N-[2-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-2-oxoethyl]pyrazine-2-carboxamide (PubChem CID 142990533) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-[2-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-2-oxoethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-2-oxoethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 142990533 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[2-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-2-oxoethyl]pyrazine-2-carboxamide |
| SMILES | CC(C)(C)C(C=O)NC(=O)CNC(=O)c1cnccn1 |
| InChI | InChI=1S/C13H18N4O3/c1-13(2,3)10(8-18)17-11(19)7-16-12(20)9-6-14-4-5-15-9/h4-6,8,10H,7H2,1-3H3,(H,16,20)(H,17,19) |
| InChIKey | DAYBFOJSOKNWKZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|