C19H25BN4O4 — CID 68718388
[3-methyl-4-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid (PubChem CID 68718388) has the molecular formula C19H25BN4O4 and a molecular weight of 384.25 g/mol. Its IUPAC name is [3-methyl-4-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid.
| Compound Name | [3-methyl-4-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 68718388 |
| Molecular Formula | C19H25BN4O4 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [3-methyl-4-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
| SMILES | CC(CCB(O)O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)c1cnccn1 |
| InChI | InChI=1S/C19H25BN4O4/c1-14(7-8-20(27)28)12-23-18(25)16(11-15-5-3-2-4-6-15)24-19(26)17-13-21-9-10-22-17/h2-6,9-10,13-14,16,27-28H,7-8,11-12H2,1H3,(H,23,25)(H,24,26)/t14?,16-/m0/s1 |
| InChIKey | RUIGLNTWDDCDQW-WMCAAGNKSA-N |
| XLogP | 0.43 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|