C20H26BN3O4 — CID 159714062
[(4R)-2-methyl-6-oxo-8-phenyl-7-(pyrazine-2-carbonylamino)octan-4-yl]boronic acid (PubChem CID 159714062) has the molecular formula C20H26BN3O4 and a molecular weight of 383.26 g/mol. Its IUPAC name is [(4R)-2-methyl-6-oxo-8-phenyl-7-(pyrazine-2-carbonylamino)octan-4-yl]boronic acid.
| Compound Name | [(4R)-2-methyl-6-oxo-8-phenyl-7-(pyrazine-2-carbonylamino)octan-4-yl]boronic acid |
|---|---|
| PubChem CID | 159714062 |
| Molecular Formula | C20H26BN3O4 |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | [(4R)-2-methyl-6-oxo-8-phenyl-7-(pyrazine-2-carbonylamino)octan-4-yl]boronic acid |
| SMILES | CC(C)CC(CC(=O)C(Cc1ccccc1)NC(=O)c1cnccn1)B(O)O |
| InChI | InChI=1S/C20H26BN3O4/c1-14(2)10-16(21(27)28)12-19(25)17(11-15-6-4-3-5-7-15)24-20(26)18-13-22-8-9-23-18/h3-9,13-14,16-17,27-28H,10-12H2,1-2H3,(H,24,26) |
| InChIKey | XCOGEZGGEXBEIJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|