C24H23BN4O3 — CID 175503896
[1-[3-[3-(2-cyano-2-pyrazin-2-ylethenyl)phenyl]propanoylamino]-2-phenylethyl]boronic acid (PubChem CID 175503896) has the molecular formula C24H23BN4O3 and a molecular weight of 426.29 g/mol. Its IUPAC name is [1-[3-[3-(2-cyano-2-pyrazin-2-ylethenyl)phenyl]propanoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[3-[3-(2-cyano-2-pyrazin-2-ylethenyl)phenyl]propanoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 175503896 |
| Molecular Formula | C24H23BN4O3 |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [1-[3-[3-(2-cyano-2-pyrazin-2-ylethenyl)phenyl]propanoylamino]-2-phenylethyl]boronic acid |
| SMILES | N#CC(=Cc1cccc(CCC(=O)NC(Cc2ccccc2)B(O)O)c1)c1cnccn1 |
| InChI | InChI=1S/C24H23BN4O3/c26-16-21(22-17-27-11-12-28-22)14-20-8-4-7-19(13-20)9-10-24(30)29-23(25(31)32)15-18-5-2-1-3-6-18/h1-8,11-14,17,23,31-32H,9-10,15H2,(H,29,30) |
| InChIKey | PQQIWLRWOQFLDP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|