C27H25BF3N3O4 — CID 151009689
[(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]ethoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid (PubChem CID 151009689) has the molecular formula C27H25BF3N3O4 and a molecular weight of 523.32 g/mol. Its IUPAC name is [(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]ethoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid.
| Compound Name | [(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]ethoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 151009689 |
| Molecular Formula | C27H25BF3N3O4 |
| Molecular Weight | 523.32 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | [(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]ethoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid |
| SMILES | Cc1ccc(C[C@H](NC(=O)OCCc2cccc(C=C(C#N)c3ccc(C(F)(F)F)cn3)c2)B(O)O)cc1 |
| InChI | InChI=1S/C27H25BF3N3O4/c1-18-5-7-20(8-6-18)15-25(28(36)37)34-26(35)38-12-11-19-3-2-4-21(13-19)14-22(16-32)24-10-9-23(17-33-24)27(29,30)31/h2-10,13-14,17,25,36-37H,11-12,15H2,1H3,(H,34,35)/t25-/m0/s1 |
| InChIKey | LVVCIFFKNGLELB-VWLOTQADSA-N |
| XLogP | 4.36 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|