C22H25BN2O2 — CID 174135412
[3-(2-cyanoprop-1-enyl)phenyl]methyl N-(1-dimethylboranyl-2-phenylethyl)carbamate (PubChem CID 174135412) has the molecular formula C22H25BN2O2 and a molecular weight of 360.27 g/mol. Its IUPAC name is [3-(2-cyanoprop-1-enyl)phenyl]methyl N-(1-dimethylboranyl-2-phenylethyl)carbamate.
| Compound Name | [3-(2-cyanoprop-1-enyl)phenyl]methyl N-(1-dimethylboranyl-2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 174135412 |
| Molecular Formula | C22H25BN2O2 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [3-(2-cyanoprop-1-enyl)phenyl]methyl N-(1-dimethylboranyl-2-phenylethyl)carbamate |
| SMILES | CB(C)C(Cc1ccccc1)NC(=O)OCc1cccc(C=C(C)C#N)c1 |
| InChI | InChI=1S/C22H25BN2O2/c1-17(15-24)12-19-10-7-11-20(13-19)16-27-22(26)25-21(23(2)3)14-18-8-5-4-6-9-18/h4-13,21H,14,16H2,1-3H3,(H,25,26) |
| InChIKey | ULTMYSNMKSXSAR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|