C26H26BF3N4O3 — CID 162573317
[(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]phenyl]ethylcarbamoylamino]-2-phenylethyl]boronic acid (PubChem CID 162573317) has the molecular formula C26H26BF3N4O3 and a molecular weight of 510.33 g/mol. Its IUPAC name is [(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]phenyl]ethylcarbamoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]phenyl]ethylcarbamoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 162573317 |
| Molecular Formula | C26H26BF3N4O3 |
| Molecular Weight | 510.33 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | [(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]phenyl]ethylcarbamoylamino]-2-phenylethyl]boronic acid |
| SMILES | N#CC(Cc1cccc(CCNC(=O)N[C@@H](Cc2ccccc2)B(O)O)c1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C26H26BF3N4O3/c28-26(29,30)22-9-10-23(33-17-22)21(16-31)14-20-8-4-7-19(13-20)11-12-32-25(35)34-24(27(36)37)15-18-5-2-1-3-6-18/h1-10,13,17,21,24,36-37H,11-12,14-15H2,(H2,32,34,35)/t21?,24-/m0/s1 |
| InChIKey | LPHSPAKJWVRNBB-FHZUCYEKSA-N |
| XLogP | 3.42 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|