C22H13ClF3N3O — CID 24662574
4-chloro-N-[3-[(Z)-2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]benzamide (PubChem CID 24662574) has the molecular formula C22H13ClF3N3O and a molecular weight of 427.81 g/mol. Its IUPAC name is 4-chloro-N-[3-[(Z)-2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]benzamide.
| Compound Name | 4-chloro-N-[3-[(Z)-2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 24662574 |
| Molecular Formula | C22H13ClF3N3O |
| Molecular Weight | 427.81 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 4-chloro-N-[3-[(Z)-2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]benzamide |
| SMILES | N#C/C(=C\c1cccc(NC(=O)c2ccc(Cl)cc2)c1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C22H13ClF3N3O/c23-18-7-4-15(5-8-18)21(30)29-19-3-1-2-14(11-19)10-16(12-27)20-9-6-17(13-28-20)22(24,25)26/h1-11,13H,(H,29,30)/b16-10+ |
| InChIKey | UDXDDAKNGNQPBH-MHWRWJLKSA-N |
| XLogP | 6.07 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.81 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|