C16H11F3N2S — CID 24662539
(Z)-3-(4-methylsulfanylphenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile (PubChem CID 24662539) has the molecular formula C16H11F3N2S and a molecular weight of 320.34 g/mol. Its IUPAC name is (Z)-3-(4-methylsulfanylphenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile.
| Compound Name | (Z)-3-(4-methylsulfanylphenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 24662539 |
| Molecular Formula | C16H11F3N2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (Z)-3-(4-methylsulfanylphenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile |
| SMILES | CSc1ccc(/C=C(\C#N)c2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C16H11F3N2S/c1-22-14-5-2-11(3-6-14)8-12(9-20)15-7-4-13(10-21-15)16(17,18)19/h2-8,10H,1H3/b12-8+ |
| InChIKey | ASUHNJUEMJCRMA-XYOKQWHBSA-N |
| XLogP | 4.89 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|