C15H7Cl2F3N2 — CID 24662540
(Z)-3-(2,6-dichlorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile (PubChem CID 24662540) has the molecular formula C15H7Cl2F3N2 and a molecular weight of 343.14 g/mol. Its IUPAC name is (Z)-3-(2,6-dichlorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile.
| Compound Name | (Z)-3-(2,6-dichlorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 24662540 |
| Molecular Formula | C15H7Cl2F3N2 |
| Molecular Weight | 343.14 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | (Z)-3-(2,6-dichlorophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1c(Cl)cccc1Cl)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H7Cl2F3N2/c16-12-2-1-3-13(17)11(12)6-9(7-21)14-5-4-10(8-22-14)15(18,19)20/h1-6,8H/b9-6+ |
| InChIKey | KJHFKSLVCDVVHD-RMKNXTFCSA-N |
| XLogP | 5.47 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.14 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|