C15H8BrF3N2 — CID 24662545
(Z)-3-(2-bromophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile (PubChem CID 24662545) has the molecular formula C15H8BrF3N2 and a molecular weight of 353.14 g/mol. Its IUPAC name is (Z)-3-(2-bromophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile.
| Compound Name | (Z)-3-(2-bromophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 24662545 |
| Molecular Formula | C15H8BrF3N2 |
| Molecular Weight | 353.14 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | (Z)-3-(2-bromophenyl)-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccccc1Br)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H8BrF3N2/c16-13-4-2-1-3-10(13)7-11(8-20)14-6-5-12(9-21-14)15(17,18)19/h1-7,9H/b11-7+ |
| InChIKey | KESSLFWBDVJYGD-YRNVUSSQSA-N |
| XLogP | 4.93 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.14 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|