C19H12F3N5O2 — CID 103598541
3-[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile (PubChem CID 103598541) has the molecular formula C19H12F3N5O2 and a molecular weight of 399.33 g/mol. Its IUPAC name is 3-[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile.
| Compound Name | 3-[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 103598541 |
| Molecular Formula | C19H12F3N5O2 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 3-[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]-2-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enenitrile |
| SMILES | Cn1cc(C=C(C#N)c2ccc(C(F)(F)F)cn2)c(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H12F3N5O2/c1-26-11-14(18(25-26)12-2-5-16(6-3-12)27(28)29)8-13(9-23)17-7-4-15(10-24-17)19(20,21)22/h2-8,10-11H,1H3 |
| InChIKey | PBVQWNZRWOJSHJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 97.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|