C22H14F3N3O4 — CID 142697220
(Z)-3-[2-(4-hydroxy-3-methoxyphenyl)-5-nitrophenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]prop-2-enenitrile (PubChem CID 142697220) has the molecular formula C22H14F3N3O4 and a molecular weight of 441.37 g/mol. Its IUPAC name is (Z)-3-[2-(4-hydroxy-3-methoxyphenyl)-5-nitrophenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]prop-2-enenitrile.
| Compound Name | (Z)-3-[2-(4-hydroxy-3-methoxyphenyl)-5-nitrophenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142697220 |
| Molecular Formula | C22H14F3N3O4 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | (Z)-3-[2-(4-hydroxy-3-methoxyphenyl)-5-nitrophenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]prop-2-enenitrile |
| SMILES | COc1cc(-c2ccc([N+](=O)[O-])cc2/C=C(\C#N)c2ccc(C(F)(F)F)nc2)ccc1O |
| InChI | InChI=1S/C22H14F3N3O4/c1-32-20-10-13(2-6-19(20)29)18-5-4-17(28(30)31)9-15(18)8-16(11-26)14-3-7-21(27-12-14)22(23,24)25/h2-10,12,29H,1H3/b16-8+ |
| InChIKey | HESVPDIYKFQSDU-LZYBPNLTSA-N |
| XLogP | 5.45 |
| TPSA | 109.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|