C17H13N3O6 — CID 126216435
(E)-3-(2,4-dimethoxy-5-nitrophenyl)-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126216435) has the molecular formula C17H13N3O6 and a molecular weight of 355.31 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxy-5-nitrophenyl)-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,4-dimethoxy-5-nitrophenyl)-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126216435 |
| Molecular Formula | C17H13N3O6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (E)-3-(2,4-dimethoxy-5-nitrophenyl)-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=C(/C#N)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13N3O6/c1-25-16-9-17(26-2)15(20(23)24)8-12(16)7-13(10-18)11-3-5-14(6-4-11)19(21)22/h3-9H,1-2H3/b13-7- |
| InChIKey | JESLGQQTFGKGMI-QPEQYQDCSA-N |
| XLogP | 3.58 |
| TPSA | 128.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|