C25H23BFN3O4 — CID 174105983
[1-[3-[3-(2-cyano-2-pyridin-2-ylethenyl)-2-fluorophenoxy]propanoylamino]-2-phenylethyl]boronic acid (PubChem CID 174105983) has the molecular formula C25H23BFN3O4 and a molecular weight of 459.29 g/mol. Its IUPAC name is [1-[3-[3-(2-cyano-2-pyridin-2-ylethenyl)-2-fluorophenoxy]propanoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[3-[3-(2-cyano-2-pyridin-2-ylethenyl)-2-fluorophenoxy]propanoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174105983 |
| Molecular Formula | C25H23BFN3O4 |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | [1-[3-[3-(2-cyano-2-pyridin-2-ylethenyl)-2-fluorophenoxy]propanoylamino]-2-phenylethyl]boronic acid |
| SMILES | N#CC(=Cc1cccc(OCCC(=O)NC(Cc2ccccc2)B(O)O)c1F)c1ccccn1 |
| InChI | InChI=1S/C25H23BFN3O4/c27-25-19(16-20(17-28)21-10-4-5-13-29-21)9-6-11-22(25)34-14-12-24(31)30-23(26(32)33)15-18-7-2-1-3-8-18/h1-11,13,16,23,32-33H,12,14-15H2,(H,30,31) |
| InChIKey | IFUMDQRVZYRPAN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|