C24H29BFN3O5 — CID 142595821
[1-[3-[5-[3-cyano-4-(dimethylamino)-4-oxobutan-2-yl]-2-fluorophenoxy]propanoylamino]-2-phenylethyl]boronic acid (PubChem CID 142595821) has the molecular formula C24H29BFN3O5 and a molecular weight of 469.32 g/mol. Its IUPAC name is [1-[3-[5-[3-cyano-4-(dimethylamino)-4-oxobutan-2-yl]-2-fluorophenoxy]propanoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[3-[5-[3-cyano-4-(dimethylamino)-4-oxobutan-2-yl]-2-fluorophenoxy]propanoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 142595821 |
| Molecular Formula | C24H29BFN3O5 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | [1-[3-[5-[3-cyano-4-(dimethylamino)-4-oxobutan-2-yl]-2-fluorophenoxy]propanoylamino]-2-phenylethyl]boronic acid |
| SMILES | CC(c1ccc(F)c(OCCC(=O)NC(Cc2ccccc2)B(O)O)c1)C(C#N)C(=O)N(C)C |
| InChI | InChI=1S/C24H29BFN3O5/c1-16(19(15-27)24(31)29(2)3)18-9-10-20(26)21(14-18)34-12-11-23(30)28-22(25(32)33)13-17-7-5-4-6-8-17/h4-10,14,16,19,22,32-33H,11-13H2,1-3H3,(H,28,30) |
| InChIKey | QDQIHPGTXAGFRZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|