C27H36BN3O5 — CID 174135808
[(1R)-1-[2-[3-[3-cyano-4-(diethylamino)-2-methyl-4-oxobutyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid (PubChem CID 174135808) has the molecular formula C27H36BN3O5 and a molecular weight of 493.41 g/mol. Its IUPAC name is [(1R)-1-[2-[3-[3-cyano-4-(diethylamino)-2-methyl-4-oxobutyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[2-[3-[3-cyano-4-(diethylamino)-2-methyl-4-oxobutyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174135808 |
| Molecular Formula | C27H36BN3O5 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | [(1R)-1-[2-[3-[3-cyano-4-(diethylamino)-2-methyl-4-oxobutyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid |
| SMILES | CCN(CC)C(=O)C(C#N)C(C)Cc1cccc(CCOC(=O)N[C@@H](Cc2ccccc2)B(O)O)c1 |
| InChI | InChI=1S/C27H36BN3O5/c1-4-31(5-2)26(32)24(19-29)20(3)16-23-13-9-12-22(17-23)14-15-36-27(33)30-25(28(34)35)18-21-10-7-6-8-11-21/h6-13,17,20,24-25,34-35H,4-5,14-16,18H2,1-3H3,(H,30,33)/t20?,24?,25-/m0/s1 |
| InChIKey | XLVVDWALJKQPGQ-VZTJNBFISA-N |
| XLogP | 2.77 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|