C17H21N3O2 — CID 170263578
2-cyano-N,N-diethyl-3-[3-(2-isocyanatoethyl)phenyl]propanamide (PubChem CID 170263578) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-cyano-N,N-diethyl-3-[3-(2-isocyanatoethyl)phenyl]propanamide.
| Compound Name | 2-cyano-N,N-diethyl-3-[3-(2-isocyanatoethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 170263578 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-cyano-N,N-diethyl-3-[3-(2-isocyanatoethyl)phenyl]propanamide |
| SMILES | CCN(CC)C(=O)C(C#N)Cc1cccc(CCN=C=O)c1 |
| InChI | InChI=1S/C17H21N3O2/c1-3-20(4-2)17(22)16(12-18)11-15-7-5-6-14(10-15)8-9-19-13-21/h5-7,10,16H,3-4,8-9,11H2,1-2H3 |
| InChIKey | VOTBPRCGJCNEOU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|