C14H16ClFN2O — CID 82139803
3-(2-chloro-6-fluorophenyl)-2-cyano-N,N-diethylpropanamide (PubChem CID 82139803) has the molecular formula C14H16ClFN2O and a molecular weight of 282.75 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-2-cyano-N,N-diethylpropanamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-2-cyano-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 82139803 |
| Molecular Formula | C14H16ClFN2O |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-2-cyano-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C#N)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H16ClFN2O/c1-3-18(4-2)14(19)10(9-17)8-11-12(15)6-5-7-13(11)16/h5-7,10H,3-4,8H2,1-2H3 |
| InChIKey | BOBJSRKAKGGONZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |