C33H44BN3O7 — CID 174135864
[(1R)-1-[2-[3-[4-[bis(oxan-4-yl)amino]-3-cyano-2-methyl-4-oxobutyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid (PubChem CID 174135864) has the molecular formula C33H44BN3O7 and a molecular weight of 605.54 g/mol. Its IUPAC name is [(1R)-1-[2-[3-[4-[bis(oxan-4-yl)amino]-3-cyano-2-methyl-4-oxobutyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[2-[3-[4-[bis(oxan-4-yl)amino]-3-cyano-2-methyl-4-oxobutyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174135864 |
| Molecular Formula | C33H44BN3O7 |
| Molecular Weight | 605.54 g/mol |
| Exact Mass | 605.33 |
| IUPAC Name | [(1R)-1-[2-[3-[4-[bis(oxan-4-yl)amino]-3-cyano-2-methyl-4-oxobutyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid |
| SMILES | CC(Cc1cccc(CCOC(=O)N[C@@H](Cc2ccccc2)B(O)O)c1)C(C#N)C(=O)N(C1CCOCC1)C1CCOCC1 |
| InChI | InChI=1S/C33H44BN3O7/c1-24(30(23-35)32(38)37(28-11-15-42-16-12-28)29-13-17-43-18-14-29)20-27-9-5-8-26(21-27)10-19-44-33(39)36-31(34(40)41)22-25-6-3-2-4-7-25/h2-9,21,24,28-31,40-41H,10-20,22H2,1H3,(H,36,39)/t24?,30?,31-/m0/s1 |
| InChIKey | OWBWSXZVJFXDLG-ZDKODALBSA-N |
| XLogP | 3.08 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|