C29H33BN4O6 — CID 175045479
[1-[1-[3-cyano-5-[2-cyano-3-[ethyl(oxan-4-yl)amino]-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid (PubChem CID 175045479) has the molecular formula C29H33BN4O6 and a molecular weight of 544.42 g/mol. Its IUPAC name is [1-[1-[3-cyano-5-[2-cyano-3-[ethyl(oxan-4-yl)amino]-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[1-[3-cyano-5-[2-cyano-3-[ethyl(oxan-4-yl)amino]-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 175045479 |
| Molecular Formula | C29H33BN4O6 |
| Molecular Weight | 544.42 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | [1-[1-[3-cyano-5-[2-cyano-3-[ethyl(oxan-4-yl)amino]-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]-2-phenylethyl]boronic acid |
| SMILES | CCN(C(=O)C(C#N)=Cc1cc(C#N)cc(C(C)OC(=O)NC(Cc2ccccc2)B(O)O)c1)C1CCOCC1 |
| InChI | InChI=1S/C29H33BN4O6/c1-3-34(26-9-11-39-12-10-26)28(35)25(19-32)15-22-13-23(18-31)16-24(14-22)20(2)40-29(36)33-27(30(37)38)17-21-7-5-4-6-8-21/h4-8,13-16,20,26-27,37-38H,3,9-12,17H2,1-2H3,(H,33,36) |
| InChIKey | QPBTXIYGEQKWOW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 155.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|